CAS 76970-24-6

L-Alanine, 3-[[(phenylmethoxy)carbonyl]amino]-, ethyl ester, monohydrochloride

Description:

L-Alanine, 3-[[(phenylmethoxy)carbonyl]amino]-, ethyl ester, monohydrochloride, with the CAS number 76970-24-6, is a chemical compound that belongs to the class of amino acid derivatives. It features an L-alanine backbone, which is a non-essential amino acid important in protein synthesis. The compound is characterized by the presence of a phenylmethoxycarbonyl group, which enhances its stability and solubility, making it useful in various biochemical applications. The ethyl ester form indicates that it has an ethyl group attached to the carboxylic acid functional group, which can influence its reactivity and bioavailability. As a monohydrochloride salt, it is typically more soluble in water, facilitating its use in pharmaceutical formulations. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a building block in peptide synthesis. Its specific applications can vary, but it is often explored in the context of drug development and biochemical research due to its structural characteristics.

Formula: C₁₃H₁₈N₂O₄·ClH

InChI: InChI=1S/C13H18N2O4.ClH/c1-2-18-12(16)11(14)8-15-13(17)19-9-10-6-4-3-5-7-10;/h3-7,11H,2,8-9,14H2,1H3,(H,15,17);1H/t11-;/m0./s1

InChI key: InChIKey=HDTDCUUIXUEMMT-MERQFXBCSA-N

SMILES: C(OC(NC[C@@H](C(OCC)=O)N)=O)C1=CC=CC=C1.Cl

Synonyms:

• L-Alanine, 3-[[(phenylmethoxy)carbonyl]amino]-, ethyl ester, monohydrochloride