CAS 76974-79-3
:(3E,3aR,8bS)-3-({[(2S)-4-methyl-5-oxo-2,5-dihydrofuran-2-yl]oxy}methylidene)-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]furan-2-one
Description:
The chemical substance with the name "(3E,3aR,8bS)-3-({[(2S)-4-methyl-5-oxo-2,5-dihydrofuran-2-yl]oxy}methylidene)-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]furan-2-one" and CAS number "76974-79-3" is a complex organic compound characterized by its unique structural features, including multiple fused ring systems and functional groups. It contains a tetrahydro-2H-indeno[1,2-b]furan core, which contributes to its potential biological activity. The presence of a furan moiety and a ketone group suggests that it may participate in various chemical reactions, including nucleophilic attacks and cycloadditions. The stereochemistry indicated by the specific configuration at various chiral centers suggests that the compound may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their structural complexity and potential therapeutic applications. Further studies would be necessary to elucidate its specific properties, reactivity, and biological activity.
Formula:C17H14O5
InChI:InChI=1/C17H14O5/c1-9-6-14(21-16(9)18)20-8-13-12-7-10-4-2-3-5-11(10)15(12)22-17(13)19/h2-6,8,12,14-15H,7H2,1H3/b13-8+/t12-,14+,15-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
rel-(3E,3aR,8bS)-3-[[[(2R)-2,5-Dihydro-4-methyl-5-oxo-2-furanyl]oxy]methylene]-3,3a,4,8b-tetrahydro-2H-indeno[1,2-b]furan-2-one
CAS:Formula:C17H14O5Purity:98%Color and Shape:SolidMolecular weight:298.2901rac-GR24
CAS:rac-GR24Formula:C17H14O5Purity:By hplc: 99.8% (Typical Value in Batch COA)Color and Shape: white solidMolecular weight:298.29006g/molStrigolactone GR24
CAS:Strigolactone GR24 is a synthetic analog of strigolactones, which are a class of plant hormones derived from the carotenoid biosynthetic pathway. These compounds play a critical role in plant development and interaction with the environment. Strigolactone GR24 functions by mimicking the action of natural strigolactones, influencing plant architecture and facilitating communication with symbiotic organisms.Formula:C17H14O5Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:298.29 g/mol




