CymitQuimica logo

CAS 76979-31-2

:

5-[(3-methoxyphenyl)methylidene]-2-thioxo-1,3-thiazolidin-4-one

Description:
5-[(3-Methoxyphenyl)methylidene]-2-thioxo-1,3-thiazolidin-4-one is a thiazolidinone derivative characterized by its unique thiazolidine ring structure, which incorporates a thione functional group. This compound features a methoxy-substituted phenyl group attached to a methylene bridge, contributing to its potential biological activity. The thiazolidinone framework is known for its role in various pharmacological applications, including anti-inflammatory and antimicrobial properties. The presence of the thione group enhances its reactivity and may facilitate interactions with biological targets. Additionally, the methoxy group can influence the compound's solubility and lipophilicity, affecting its bioavailability. The compound's molecular structure suggests potential for further modifications, which could lead to the development of novel therapeutic agents. As with many thiazolidinones, it may exhibit interesting chemical behavior under different conditions, making it a subject of interest in medicinal chemistry and drug design.
Formula:C11H9NO2S2
InChI:InChI=1/C11H9NO2S2/c1-14-8-4-2-3-7(5-8)6-9-10(13)12-11(15)16-9/h2-6H,1H3,(H,12,13,15)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.