CAS 7698-97-7
:5-Ethyl-6-methyl-4-phenyl-3-cyclohexene-1-carboxylic acid
Description:
The chemical substance known as "5-Ethyl-6-methyl-4-phenyl-3-cyclohexene-1-carboxylic acid" with the CAS number 7698-97-7 is characterized by its complex organic structure, which includes a cyclohexene ring, multiple alkyl substituents, and a carboxylic acid functional group. This compound typically exhibits properties associated with aromatic and aliphatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid group. The presence of the phenyl group contributes to its aromatic characteristics, which may influence its stability and reactivity. Additionally, the ethyl and methyl groups provide steric hindrance, potentially affecting its interactions with other molecules. This compound may be of interest in organic synthesis, pharmaceuticals, or materials science due to its unique structural features. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C16H20O2
InChI:InChI=1S/C16H20O2/c1-3-13-11(2)14(16(17)18)9-10-15(13)12-7-5-4-6-8-12/h4-8,10-11,13-14H,3,9H2,1-2H3,(H,17,18)
InChI key:InChIKey=CLMFEXDZPBGYQQ-UHFFFAOYSA-N
SMILES:C(C)C1C(=CCC(C(O)=O)C1C)C2=CC=CC=C2
Synonyms:- ORF 3858
- 2-Methyl-3-ethyl-4-phenylcyclohex-4-enecarboxylic acid
- 3-Cyclohexene-1-carboxylic acid, 5-ethyl-6-methyl-4-phenyl-
- 5-Ethyl-6-methyl-4-phenyl-3-cyclohexene-1-carboxylic acid
- Fenestrel
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
