CAS 76982-24-6

5-Chloro-2-methylquinoxaline

Description:

5-Chloro-2-methylquinoxaline is a heterocyclic organic compound characterized by its quinoxaline structure, which consists of a fused benzene and pyrazine ring. This compound features a chlorine atom at the 5-position and a methyl group at the 2-position of the quinoxaline ring, contributing to its unique chemical properties. It is typically a pale yellow to brown solid, and its molecular formula is C9H8ClN3. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. 5-Chloro-2-methylquinoxaline is of interest in medicinal chemistry and material science due to its biological activity and potential applications in pharmaceuticals. It may exhibit antimicrobial, antifungal, or anticancer properties, although specific biological activities can vary based on structural modifications and the presence of other functional groups. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and environmental impact.

Formula: C₉H₇ClN₂

InChI: InChI=1S/C9H7ClN2/c1-6-5-11-9-7(10)3-2-4-8(9)12-6/h2-5H,1H3

InChI key: InChIKey=NHXVYUAOSUAMLX-UHFFFAOYSA-N

SMILES: ClC=1C2=C(N=C(C)C=N2)C=CC1

Synonyms:

• 5-Chloro-2-methylquinoxaline
• Quinoxaline, 5-chloro-2-methyl-