
CAS 7699-23-2
:1,3-Dihydro-7-methoxy-1-methyl-2H-indol-2-one
Description:
1,3-Dihydro-7-methoxy-1-methyl-2H-indol-2-one, with the CAS number 7699-23-2, is an organic compound belonging to the indole family, characterized by its bicyclic structure that includes a fused benzene and pyrrole ring. This compound features a methoxy group (-OCH3) and a methyl group (-CH3) attached to the indole framework, which can influence its chemical reactivity and biological activity. Typically, indole derivatives exhibit a range of pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer activities, making them of interest in medicinal chemistry. The presence of the methoxy group can enhance lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. Additionally, the compound may participate in various chemical reactions, such as electrophilic substitutions, due to the electron-rich nature of the indole nitrogen. Overall, 1,3-Dihydro-7-methoxy-1-methyl-2H-indol-2-one represents a structurally interesting molecule with potential applications in drug development and organic synthesis.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c1-11-9(12)6-7-4-3-5-8(13-2)10(7)11/h3-5H,6H2,1-2H3
InChI key:InChIKey=QDBHDDVJPQBXBZ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(CC(=O)N2C)=CC=C1
Synonyms:- 7-Methoxy-1-methyl-2-oxindole
- 1,3-Dihydro-7-methoxy-1-methyl-2H-indol-2-one
- 2-Indolinone, 7-methoxy-1-methyl-
- 2H-Indol-2-one, 1,3-dihydro-7-methoxy-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.