CAS 769920-90-3

1-{2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl}methanamine

Description:

1-{2-[4-(Trifluoromethyl)phenyl]-1,3-thiazol-4-yl}methanamine, with the CAS number 769920-90-3, is a chemical compound characterized by its unique structural features. It contains a thiazole ring, which is a five-membered heterocyclic compound containing sulfur and nitrogen, contributing to its biological activity. The presence of a trifluoromethyl group (-CF3) on the phenyl ring enhances its lipophilicity and can influence its pharmacokinetic properties, making it potentially useful in medicinal chemistry. The methanamine functional group indicates that it has an amine (-NH2) moiety, which can participate in hydrogen bonding and may play a role in its reactivity and interaction with biological targets. This compound may exhibit various biological activities, making it of interest in drug discovery and development. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in the molecule.

Formula: C₁₁H₉F₃N₂S

InChI: InChI=1/C11H9F3N2S/c12-11(13,14)8-3-1-7(2-4-8)10-16-9(5-15)6-17-10/h1-4,6H,5,15H2

SMILES: c1cc(ccc1c1nc(CN)cs1)C(F)(F)F

Synonyms:

• {2-[4-(Trifluoromethyl)Phenyl]-1,3-Thiazol-4-Yl}Methylamine