CAS 769928-20-3

N-(4-amino-2-methylphenyl)butanamide

Description:

N-(4-amino-2-methylphenyl)butanamide, also known by its CAS number 769928-20-3, is an organic compound characterized by its amide functional group and an aromatic amine structure. This substance features a butanamide chain attached to a 4-amino-2-methylphenyl moiety, which contributes to its potential biological activity. The presence of the amino group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit properties such as moderate to high polarity, which can affect their interaction with biological systems. The molecular structure suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. Additionally, the compound's stability, melting point, and solubility characteristics would depend on the specific conditions and solvents used. Safety data should be consulted for handling and potential toxicity, as with any chemical substance. Overall, N-(4-amino-2-methylphenyl)butanamide represents a class of compounds that may have significant implications in medicinal chemistry and related fields.

Formula: C₁₁H₁₆N₂O

InChI: InChI=1/C11H16N2O/c1-3-4-11(14)13-10-6-5-9(12)7-8(10)2/h5-7H,3-4,12H2,1-2H3,(H,13,14)

SMILES: CCCC(=O)Nc1ccc(cc1C)N