CAS 769951-32-8

7H-pyrrolo[2,3-d]pyrimidin-4-amine sulfate

Description:

7H-pyrrolo[2,3-d]pyrimidin-4-amine sulfate is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound typically exhibits properties associated with heterocyclic amines, including potential biological activity. The presence of the sulfate group suggests that it may be soluble in water and could participate in various chemical reactions, including those involving nucleophiles or electrophiles. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound may also exhibit specific pharmacological properties, which can be explored in the context of its application in therapeutic settings. As with many heterocycles, the stability and reactivity of 7H-pyrrolo[2,3-d]pyrimidin-4-amine sulfate can be influenced by factors such as pH and the presence of other chemical species. Overall, this compound represents a class of molecules that are significant in both synthetic and medicinal chemistry.

Formula: C₆H₈N₄O₄S

InChI: InChI=1/C6H6N4.H2O4S/c7-5-4-1-2-8-6(4)10-3-9-5;1-5(2,3)4/h1-3H,(H3,7,8,9,10);(H2,1,2,3,4)

SMILES: c1cnc2c1c(N)nc[nH]2.OS(=O)(=O)O

Synonyms:

• 1H-Pyrrolo[2,3-d]pyrimidin-4-amine sulfate
• 7H-Pyrrolo[2,3-d]pyrimidin-4-amine sulfate (1:1)
• 7H-Pyrrolo[2,3-d]pyrimidin-4-amine sulphate

4-Amino-7h-pyrrolo[2,3-d]pyrimidine hydrogen sulfate

CAS: 769951-32-8

Formula: C₆H₈N₄O₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 232.2171

Ref: IN-DA0036MZ

4-Amino-7H-pyrrolo[2,3-d]pyrimidine sulphate

CAS: 769951-32-8

4-Amino-7H-pyrrolo[2,3-d]pyrimidine sulphate

Purity: 95%

Color and Shape: Solid

Molecular weight: 232.21712g/mol

Ref: 54-OR2834

4-Amino-7H-pyrrolo[2,3-d]pyrimidine hydrogen sulfate

CAS: 769951-32-8

Formula: C₆H₈N₄O₄S

Purity: 98%+;RG

Molecular weight: 232.21

Ref: 10-F079940

4-Amino-7H-pyrrolo[2,3-d]pyrimidine hydrogen sulfate

CAS: 769951-32-8

4-Amino-7H-pyrrolo[2,3-d]pyrimidine hydrogen sulfate is a rearrangement product of furoxan and a potential intermediate in the biosynthesis of carboxyl compounds. It is also an hypotensive agent that was found to be effective in lowering blood pressure and lowering lipid levels. 4-Amino-7H-pyrrolo[2,3-d]pyrimidine hydrogen sulfate has been shown to have chlorine and peracetic acid reactivity. The compound can be used as a reagent for the synthesis of carboxylic acid derivatives by reacting with arylhydrazones, such as 1,1'-carbonyldiimidazole or 3,4-dimethoxybenzoylhydrazone. 4-Amino-7H-pyrrolo[2,3-d]pyrimidine hydrogen sulfate can also

Purity: Min. 95%

Ref: 3D-NA44317