CAS 76996-28-6

Garcinone B

Description:

Garcinone B is a naturally occurring chemical compound classified as a flavonoid, specifically a type of polyphenolic compound. It is primarily derived from the Garcinia species, which are known for their diverse phytochemical profiles. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. Garcinone B is characterized by its unique chemical structure, which includes multiple hydroxyl groups that contribute to its reactivity and interaction with biological systems. Its solubility properties can vary depending on the solvent used, and it may exhibit different behaviors in various pH environments. Additionally, Garcinone B's stability and efficacy can be influenced by factors such as light exposure and temperature. As research continues, the potential applications of Garcinone B in health and medicine are being explored, particularly in the context of natural product chemistry and therapeutic development.

Formula: C₂₃H₂₂O₆

InChI: InChI=1S/C23H22O6/c1-11(2)5-6-12-14(24)9-17-19(20(12)26)21(27)18-13-7-8-23(3,4)29-22(13)15(25)10-16(18)28-17/h5,7-10,24-26H,6H2,1-4H3

InChI key: InChIKey=HVXHJNVYRXRHNX-UHFFFAOYSA-N

SMILES: O=C1C=2C3=C(C(O)=CC2OC=4C1=C(O)C(CC=C(C)C)=C(O)C4)OC(C)(C)C=C3

Synonyms:

• Pyrano[3,2-a]xanthen-12(3H)-one, 5,9,11-trihydroxy-3,3-dimethyl-10-(3-methyl-2-buten-1-yl)-
• Pyrano[3,2-a]xanthen-12(3H)-one, 5,9,11-trihydroxy-3,3-dimethyl-10-(3-methyl-2-butenyl)-
• 5,9,11-Trihydroxy-3,3-dimethyl-10-(3-methyl-2-buten-1-yl)pyrano[3,2-a]xanthen-12(3H)-one
• Garcinone B

Garcinone B

CAS: 76996-28-6

Garcinone B, a xanthone derivative naturally isolated from the pericarp of Mangosteen, serves as a potent inhibitor of ACE2 and Mpro, and is utilized in COVID-

Formula: C₂₃H₂₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 394.42

Ref: TM-T78770