CAS 76997-30-3
:Almitrine-raubasine
Description:
Almitrine-raubasine is a chemical compound that combines the properties of two pharmacologically active substances: almitrine, a respiratory stimulant, and raubasine, which has been noted for its potential neuroprotective effects. This compound is primarily studied for its effects on the central nervous system and respiratory function. Almitrine acts by enhancing the sensitivity of chemoreceptors to carbon dioxide, thereby stimulating respiration, while raubasine may influence neurotransmitter systems and exhibit vasodilatory properties. The compound is often explored in the context of treating conditions such as chronic obstructive pulmonary disease (COPD) and other respiratory disorders. Its mechanism of action involves modulation of various neurotransmitter pathways, which can lead to improved respiratory drive and potential neuroprotective benefits. As with many pharmacological agents, the safety profile, dosage, and specific therapeutic applications are critical areas of ongoing research. Overall, almitrine-raubasine represents a unique intersection of respiratory and neurological pharmacology, warranting further investigation into its clinical efficacy and safety.
Formula:C47H53F2N9O3
InChI:InChI=1/C26H29F2N7.C21H24N2O3/c1-3-13-29-24-31-25(30-14-4-2)33-26(32-24)35-17-15-34(16-18-35)23(19-5-9-21(27)10-6-19)20-7-11-22(28)12-8-20;1-12-16-10-23-8-7-14-13-5-3-4-6-18(13)22-20(14)19(23)9-15(16)17(11-26-12)21(24)25-2/h3-12,23H,1-2,13-18H2,(H2,29,30,31,32,33);3-6,11-12,15-16,19,22H,7-10H2,1-2H3/t;12-,15-,16+,19-/m.0/s1
Synonyms:- Methyl 16,17-didehydro-19-methyloxayohimban-16-carboxylate 6-(4-(bis(4-fluorophenyl)methyl)-1-piperazinyl)-N,N'-di-2-propenyl-1,3,5-triazine-2,4-diamine
- methyl (19alpha)-19-methyl-16,17-didehydro-18-oxayohimban-16-carboxylate - 6-{4-[bis(4-fluorophenyl)methyl]piperazin-1-yl}-N,N'-diprop-2-en-1-yl-1,3,5-triazine-2,4-diamine (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Almitrine-raubasine
CAS:Almitrine-raubasine is a drug that has been used in China to treat metabolic disorders. It is a mixture of two drugs, almitrine and raubasine. Almitrine-raubasine increases the metabolic rate and ATP levels by inhibiting the enzyme activity of phosphofructokinase in mitochondria. This drug also has been shown to be effective for slowing down the growth of cancer cells. Almitrine-raubasine may have potential as a drug target for cancer treatment or other metabolic diseases, such as diabetes mellitus or obesity.
Formula:C26H29F2N7•C21H24N2O3Purity:Min. 95%Molecular weight:829.98 g/mol
