CymitQuimica logo

CAS 769972-01-2

:

6-(3-Formylphenyl)-3-pyridinecarbonitrile

Description:
6-(3-Formylphenyl)-3-pyridinecarbonitrile, identified by its CAS number 769972-01-2, is an organic compound characterized by its unique structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, and a carbonitrile functional group (-C≡N) that contributes to its reactivity and polarity. The presence of the formyl group (-CHO) attached to a phenyl ring enhances its potential for various chemical reactions, including condensation and nucleophilic attacks. This compound is likely to exhibit properties typical of aromatic compounds, such as stability and the ability to participate in electrophilic aromatic substitution reactions. Additionally, the presence of both the carbonitrile and formyl groups suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Its solubility and reactivity may vary depending on the solvent and conditions used, making it a versatile compound in synthetic chemistry. Overall, 6-(3-Formylphenyl)-3-pyridinecarbonitrile is a valuable building block for further chemical transformations.
Formula:C13H8N2O
InChI:InChI=1S/C13H8N2O/c14-7-11-4-5-13(15-8-11)12-3-1-2-10(6-12)9-16/h1-6,8-9H
InChI key:InChIKey=HBIQGGHUKFQTOM-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(C=CC1)C2=CC=C(C#N)C=N2
Synonyms:
  • 3-Pyridinecarbonitrile, 6-(3-formylphenyl)-
  • 6-(3-Formylphenyl)-3-pyridinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.