CAS 77-57-6
:1-Phenylcyclopentanecarbonitrile
Description:
1-Phenylcyclopentanecarbonitrile, with the CAS number 77-57-6, is an organic compound characterized by a cyclopentane ring substituted with a phenyl group and a cyano group (nitrile). This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It has a relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. The presence of the cyano group imparts notable chemical reactivity, allowing for various reactions such as nucleophilic additions. 1-Phenylcyclopentanecarbonitrile may exhibit moderate toxicity, and appropriate safety measures should be taken when handling it. Its unique structure makes it of interest in organic synthesis and materials science, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as boiling point and melting point, can vary based on the specific conditions and purity of the sample. Overall, 1-Phenylcyclopentanecarbonitrile is a valuable compound in the field of organic chemistry.
Formula:C12H13N
InChI:InChI=1S/C12H13N/c13-10-12(8-4-5-9-12)11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-9H2
InChI key:InChIKey=GDXMFFGTPGAGGX-UHFFFAOYSA-N
SMILES:C(#N)C1(CCCC1)C2=CC=CC=C2
Synonyms:- 1-Cyano-1-phenylcyclopentane
- 1-Phenyl-1-cyclopentanecarbonitrile
- 1-Phenylcyclopentane-1-carbonitrile
- 1-Phenylcyclopentanenitrile
- Cyclopentanecarbonitrile, 1-Phenyl-
- NSC 18928
- 1-Phenylcyclopentanecarbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1-Phenyl-1-cyclopentanecarbonitrile
CAS:Formula:C12H13NPurity:96%Color and Shape:LiquidMolecular weight:171.23831-phenylcyclopentanecarbonitrile
CAS:1-phenylcyclopentanecarbonitrilePurity:98%Color and Shape:LiquidMolecular weight:171.24g/mol1-Phenylcyclopentanecarbonitrile
CAS:Formula:C12H13NPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:171.24Pentoxyverine Impurity 7 (1-Phenylcyclopentanecarbonitrile)
CAS:Formula:C12H13NMolecular weight:171.2431-Phenylcyclopentanecarbonitrile
CAS:Formula:C12H13NPurity:95%Color and Shape:LiquidMolecular weight:171.2431-Phenylcyclopentanecarbonitrile
CAS:1-Phenylcyclopentanecarbonitrile (PCN) is a chemical compound that has biological properties. It is used in the production of polyvinyl chloride, polyvinylidene chloride, and other plastics. PCN may also be used as an intermediate for the production of other chemicals such as diammonium cyanide, which is a raw material for the manufacture of fertilizers, and methoxyacetic acid, which is a precursor to pharmaceuticals. PCN has been shown to have neurotoxic effects on the nervous system in mice. It also causes atropine-like effects when administered to rats.Formula:C12H13NPurity:Min. 95%Molecular weight:171.24 g/mol






