CAS 770-08-1
:5-Ethylpicolinic acid
Description:
5-Ethylpicolinic acid, with the CAS number 770-08-1, is a heterocyclic organic compound that belongs to the class of picolinic acids. It features a pyridine ring substituted with an ethyl group at the 5-position and a carboxylic acid functional group. This compound is typically characterized by its white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. 5-Ethylpicolinic acid is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities and applications. Its derivatives may exhibit antimicrobial, anti-inflammatory, or other pharmacological effects. As with many organic compounds, proper handling and storage are essential to maintain its stability and efficacy.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-2-6-3-4-7(8(10)11)9-5-6/h3-5H,2H2,1H3,(H,10,11)
InChI key:InChIKey=SHCDHIRSCJOUBW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(CC)C=N1
Synonyms:- 2-Pyridinecarboxylic Acid, 5-Ethyl-
- 5-Ethyl-2-picolinic acid
- 5-Ethyl-2-pyridinecarboxylic acid
- 5-Ethylpicolinic Acid
- Picolinic acid, 5-ethyl-
- 5-Ethylpyridine-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-ethyl-2-pyridinecarboxylic acid
CAS:Formula:C8H9NO2Purity:97%Color and Shape:SolidMolecular weight:151.16265-Ethylpyridine-2-carboxylic Acid
CAS:Controlled ProductApplications 5-Ethylpyridine-2-carboxylic Acid (cas# 770-08-1) is a compound useful in organic synthesis.
Formula:C8H9NO2Color and Shape:NeatMolecular weight:151.165-Ethylpyridine-2-carboxylic acid
CAS:5-Ethylpyridine-2-carboxylic acid is a biologically active compound that is biosynthesized from the amino acid tryptophan. This compound is also known as 5-ethylpicolinic acid or 5-ethylpyridin-2-yl carboxylic acid. It is a phytoalexin, which is an antimicrobial agent produced by plants to inhibit pathogen growth. 5-Ethylpyridine-2-carboxylic acid has been shown to be effective against picolinic acid phosphoribosyltransferase and flavopereirine reductase in vitro, and has also been shown to have antimicrobial properties against Escherichia coli, Staphylococcus aureus, and Bacillus cereus. 5-Ethylpyridine-2-carboxylic acid can be prepared by reacting ethyl acetoacetate with pyridineFormula:C8H9NO2Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:151.16 g/mol




