
CAS 770-20-7
:N-(1,6-Dihydro-6-oxo-2-pyridinyl)acetamide
Description:
N-(1,6-Dihydro-6-oxo-2-pyridinyl)acetamide, with the CAS number 770-20-7, is a chemical compound that features a pyridine ring substituted with an acetamide group. This compound is characterized by its heterocyclic structure, which includes a six-membered ring containing nitrogen and a carbonyl group, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amide functional group. The compound may participate in various chemical reactions, including acylation and nucleophilic substitutions, owing to the electrophilic nature of the carbonyl carbon. Additionally, it may possess pharmacological properties, making it of interest in medicinal chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c1-5(10)8-6-3-2-4-7(11)9-6/h2-4H,1H3,(H2,8,9,10,11)
InChI key:InChIKey=QDAICAFPHZCCRP-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1NC(=O)C=CC1
Synonyms:- 2-Pyridinol, 6-acetamido-
- N-(1,6-Dihydro-6-oxo-2-pyridinyl)acetamide
- Acetamide, N-(1,6-dihydro-6-oxo-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
