CAS 770-30-9
:4-Amino-2-(methylthio)pyrimidine-5-carbonitrile
Description:
4-Amino-2-(methylthio)pyrimidine-5-carbonitrile, with the CAS number 770-30-9, is an organic compound that features a pyrimidine ring substituted with an amino group, a methylthio group, and a cyano group. This compound is characterized by its heterocyclic structure, which includes nitrogen atoms in the ring, contributing to its potential biological activity. The presence of the amino group suggests it may participate in hydrogen bonding, while the cyano group can enhance its reactivity and solubility in polar solvents. The methylthio group introduces a sulfur atom, which can influence the compound's electronic properties and steric effects. This substance is of interest in medicinal chemistry and agricultural applications, as derivatives of pyrimidine are often explored for their pharmacological properties. Its synthesis and reactivity can be influenced by the functional groups present, making it a versatile compound in various chemical reactions. Overall, 4-Amino-2-(methylthio)pyrimidine-5-carbonitrile is a significant compound in the study of heterocyclic chemistry and its applications in drug development.
Formula:C6H7N3OS
InChI:InChI=1/C6H7N3OS/c1-11-6-8-2-4(3-10)5(7)9-6/h2-3H,1H3,(H2,7,8,9)
SMILES:CSc1ncc(C=O)c(=N)[nH]1
Synonyms:- 5-Pyrimidinecarbonitrile, 4-Amino-2-(Methylthio)-
- 4-Amino-2-(Methylsulfanyl)Pyrimidine-5-Carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Amino-2-(methylthio)pyrimidine-5-carbonitrile, 97%
CAS:It is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed asFormula:C6H6N4SPurity:97%Color and Shape:White to cream to pale yellow, PowderMolecular weight:166.204-Amino-2-(methylthio)pyrimidine-5-carbonitrile
CAS:Formula:C6H6N4SPurity:97%Color and Shape:SolidMolecular weight:166.20364-Amino-5-cyano-2-(methylthio)pyrimidine
CAS:4-Amino-5-cyano-2-(methylthio)pyrimidinePurity:97%Color and Shape:PowderMolecular weight:166.20g/mol4-Amino-2-(methylthio)pyrimidine-5-carbonitrile
CAS:Formula:C6H6N4SPurity:97%Color and Shape:SolidMolecular weight:166.24-Amino-2-(methylthio)pyrimidine-5-carbonitrile
CAS:Versatile small molecule scaffoldFormula:C6H6N4SPurity:Min. 95%Molecular weight:166.21 g/mol




