
CAS 770-36-5
:(3E)-4-Phenyl-3-buten-1-ol
Description:
(3E)-4-Phenyl-3-buten-1-ol, with the CAS number 770-36-5, is an organic compound characterized by its structure, which features a phenyl group attached to a butenol backbone. This compound is classified as an allylic alcohol, possessing both a double bond and a hydroxyl (-OH) functional group. It typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. The presence of the phenyl group contributes to its potential reactivity and interactions, making it of interest in various chemical syntheses and applications. (3E)-4-Phenyl-3-buten-1-ol is known for its role in organic synthesis, particularly in the production of more complex molecules. It may exhibit properties such as solubility in organic solvents and limited solubility in water, which is common for many organic compounds with hydrophobic characteristics. Additionally, it may participate in various chemical reactions, including oxidation and polymerization, making it a valuable intermediate in the synthesis of pharmaceuticals and other organic materials.
Formula:C10H12O
InChI:InChI=1S/C10H12O/c11-9-5-4-8-10-6-2-1-3-7-10/h1-4,6-8,11H,5,9H2/b8-4+
InChI key:InChIKey=IAHCIRBKFCOPEE-XBXARRHUSA-N
SMILES:C(=C/CCO)\C1=CC=CC=C1
Synonyms:- 3-Buten-1-ol, 4-phenyl-, (3E)-
- (3E)-4-Phenyl-3-buten-1-ol
- trans-4-Phenyl-3-buten-1-ol
- 3-Buten-1-ol, 4-phenyl-, (E)-
- (E)-4-Phenyl-3-buten-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.