CAS 770-70-7

1-(chloromethyl)tricyclo[3.3.1.1~3,7~]decane

Description:

1-(Chloromethyl)tricyclo[3.3.1.1^3,7]decane, with the CAS number 770-70-7, is a bicyclic organic compound characterized by its unique tricyclic structure. This compound features a chloromethyl group (-CH2Cl) attached to one of the carbon atoms in the tricyclic framework, which contributes to its reactivity and potential applications in organic synthesis. The tricyclic system consists of three interconnected rings, providing a rigid and compact molecular structure that can influence its physical and chemical properties, such as boiling point, melting point, and solubility. The presence of the chlorine atom introduces polar characteristics, making the compound more reactive in nucleophilic substitution reactions. Additionally, the compound may exhibit interesting stereochemical properties due to the constraints imposed by its tricyclic nature. Overall, 1-(chloromethyl)tricyclo[3.3.1.1^3,7]decane serves as a valuable intermediate in the synthesis of more complex organic molecules and can be utilized in various chemical reactions.

Formula: C₁₁H₁₇Cl

InChI: InChI=1/C11H17Cl/c12-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-7H2

SMILES: C1C2CC3CC1CC(C2)(C3)CCl

Synonyms:

• 1-(Chloromethyl)Adamantane
• 1-Chloromethyladamantane
• 1-(Chloromethyl)Adamantine