CAS 77015-05-5

5,10-Dioxo-5H,10H-diimidazo[1,5-a:1′,5′-d]pyrazine-1,6-dicarboxylic acid

Description:

5,10-Dioxo-5H,10H-diimidazo[1,5-a:1′,5′-d]pyrazine-1,6-dicarboxylic acid, with CAS number 77015-05-5, is a heterocyclic compound characterized by its complex fused ring structure, which includes imidazole and pyrazine moieties. This compound features two carbonyl groups (dioxo) and two carboxylic acid groups (dicarboxylic acid), contributing to its potential acidity and reactivity. The presence of these functional groups suggests that it may participate in various chemical reactions, including condensation and esterification. Its unique structure may also impart interesting electronic properties, making it a candidate for applications in materials science, pharmaceuticals, or as a ligand in coordination chemistry. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Overall, 5,10-Dioxo-5H,10H-diimidazo[1,5-a:1′,5′-d]pyrazine-1,6-dicarboxylic acid is a notable compound in the realm of organic and medicinal chemistry, warranting further investigation for its potential applications.

Formula: C₁₀H₄N₄O₆

InChI: InChI=1S/C10H4N4O6/c15-7-6-4(10(19)20)12-2-14(6)8(16)5-3(9(17)18)11-1-13(5)7/h1-2H,(H,17,18)(H,19,20)

InChI key: InChIKey=QLKMAJLWDKHCKY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(C(=O)C=3N(C2=O)C=NC3C(O)=O)C=N1

Synonyms:

• 5,10-Dioxo-5H,10H-diimidazo(1,5-a:1',5'-d)pyrazine-1,6-dicarboxylic acid
• 5,10-Dioxo-5H,10H-diimidazo[1,5-a:1′,5′-d]pyrazine-1,6-dicarboxylic acid
• 5H,10H-Diimidazo[1,5-a:1′,5′-d]pyrazine-1,6-dicarboxylic acid, 5,10-dioxo-