CymitQuimica logo

CAS 77021-80-8

:

N',N'''-biphenyl-4,4'-diylbis[N-cyano(imidoformamide)]

Description:
N',N'''-biphenyl-4,4'-diylbis[N-cyano(imidoformamide)] is a complex organic compound characterized by its unique structure, which includes biphenyl and cyano-imidoformamide functional groups. This compound typically exhibits properties associated with both aromatic and amide functionalities, contributing to its potential applications in various fields, including materials science and organic synthesis. The presence of cyano groups suggests that it may participate in nucleophilic reactions, while the imidoformamide moiety can influence its solubility and reactivity. Additionally, the biphenyl backbone may impart stability and rigidity to the molecule, affecting its physical properties such as melting point and solubility in organic solvents. The compound's CAS number, 77021-80-8, allows for its identification in chemical databases, facilitating research and application in specialized areas. Overall, N',N'''-biphenyl-4,4'-diylbis[N-cyano(imidoformamide)] represents a versatile structure with potential utility in advanced chemical applications.
Formula:C16H12N6
InChI:InChI=1/C16H12N6/c17-9-19-11-21-15-5-1-13(2-6-15)14-3-7-16(8-4-14)22-12-20-10-18/h1-8,11-12H,(H,19,21)(H,20,22)
Synonyms:
  • Methanimidamide, N,N''-[1,1'-biphenyl]-4,4'-diylbis[N'-cyano-
  • N,N''-Biphenyl-4,4'-diylbis[N'-cyano(imidoformamide)]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.