CAS 77029-01-7
:6-methoxynaphthalene-1-carbonitrile
Description:
6-Methoxynaphthalene-1-carbonitrile, with the CAS number 77029-01-7, is an organic compound characterized by its naphthalene backbone substituted with a methoxy group and a cyano group. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the naphthalene structure. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents, while the cyano group (-CN) introduces polar characteristics, making it useful in various chemical reactions and applications. It may exhibit fluorescence and has potential utility in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's reactivity can be influenced by the electron-donating nature of the methoxy group and the electron-withdrawing nature of the cyano group, allowing for diverse synthetic pathways. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H9NO
InChI:InChI=1/C12H9NO/c1-14-11-5-6-12-9(7-11)3-2-4-10(12)8-13/h2-7H,1H3
SMILES:COc1ccc2c(cccc2C#N)c1
Synonyms:- 1-Cyano-6-methoxynaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.