CAS 77029-83-5
:(1S,2R)-1-acetyl-2,5,12-trihydroxy-4,8,9,13-tetramethoxy-2-methyl-2,3-dihydro-1H-cyclohepta[ghi]perylene-6,11-dione
Description:
The chemical substance known as (1S,2R)-1-acetyl-2,5,12-trihydroxy-4,8,9,13-tetramethoxy-2-methyl-2,3-dihydro-1H-cyclohepta[ghi]perylene-6,11-dione, with the CAS number 77029-83-5, is a complex organic compound characterized by its polycyclic structure and multiple functional groups. It features a cycloheptaperylene core, which is a fused polycyclic aromatic hydrocarbon, and is substituted with various hydroxyl (-OH) and methoxy (-OCH3) groups, contributing to its chemical reactivity and potential biological activity. The presence of an acetyl group indicates that it may participate in acetylation reactions. The stereochemistry, denoted by the (1S,2R) configuration, suggests specific spatial arrangements of atoms that can influence the compound's interactions and properties. Such compounds are often studied for their potential applications in pharmaceuticals, materials science, and organic synthesis due to their unique structural characteristics and functional versatility.
Formula:C30H26O10
InChI:InChI=1/C30H26O10/c1-10(31)25-24-22-16-11(9-30(25,2)36)28(39-5)26(34)17-12(32)7-14(37-3)19(21(16)17)20-15(38-4)8-13(33)18(23(20)22)27(35)29(24)40-6/h7-8,25,34-36H,9H2,1-6H3/t25-,30+/m0/s1
InChI key:InChIKey=BQJKVFXDDMQLBE-UHFFFAOYSA-N
SMILES:O(C)C1=C2C=3C4=C5C(=C6C3C(C1=O)=C(O)C=C6OC)C(OC)=CC(O)=C5C(=O)C(OC)=C4CC(C)(O)C2C(C)=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
hypocrellin A
CAS:Hypocrellin A, an a natural perylene quinine photosensitizers (PSs), can chelate with heavy metal ions, including Au(III) and Pt(IV), to form a 1:2 complex. Hypocrellin A has light-induced antitumor,antifungal and antiviral activities, it also exerts immunomodulatory effects on MHC-restricted presentation of antigen.Formula:C30H26O10Purity:95%~99%Molecular weight:546.528Hypocrellin A
CAS:Hypocrellin A is a natural PKC inhibitor with light-induced antitumor, antifungal and antiviral activities.Cost-effective and quality-assured.Formula:C30H26O10Purity:98% - 99.95%Color and Shape:SolidMolecular weight:546.52Hypocrellin A
CAS:Hypocrellin A is a photosensitive natural compound, which is derived from the fungi in the Hypocrella and Shiraia genera. It exhibits potent photodynamic properties through the generation of reactive oxygen species when exposed to specific wavelengths of light. This mode of action is primarily due to its capacity to absorb light and transfer energy to molecular oxygen, producing singlet oxygen and other reactive intermediates.Formula:C30H26O10Purity:Min. 95%Color and Shape:Red PowderMolecular weight:546.52 g/mol





