CAS 77034-34-5

ethyl 1-benzylpiperidine-2-carboxylate

Description:

Ethyl 1-benzylpiperidine-2-carboxylate is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an ethyl ester functional group and a benzyl substituent, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. Ethyl 1-benzylpiperidine-2-carboxylate is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to various bioactive compounds. The presence of the piperidine ring often imparts basic properties, making it soluble in organic solvents while exhibiting limited solubility in water. Additionally, this compound may exhibit specific reactivity patterns typical of esters and amines, such as undergoing hydrolysis or participating in nucleophilic substitution reactions. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₁₅H₂₁NO₂

InChI: InChI=1/C15H21NO2/c1-2-18-15(17)14-10-6-7-11-16(14)12-13-8-4-3-5-9-13/h3-5,8-9,14H,2,6-7,10-12H2,1H3

SMILES: CCOC(=O)C1CCCCN1Cc1ccccc1

Synonyms:

• 2-Piperidinecarboxylic Acid, 1-(Phenylmethyl)-, Ethyl Ester
• ETHYL 1-BENZYLPIPERIDINE-2-CARBOXYLATE

Ethyl 1-benzylpiperidine-2-carboxylate

CAS: 77034-34-5

Formula: C₁₅H₂₁NO₂

Molecular weight: 247.3327

Ref: IN-DA005RCB

Ethyl 1-benzylpiperidine-2-carboxylate

CAS: 77034-34-5

Ethyl 1-benzylpiperidine-2-carboxylate is an organic compound that belongs to the class of benzhydryl compounds. It is a colorless liquid at room temperature and has a boiling point of 60°C. Ethyl 1-benzylpiperidine-2-carboxylate can be synthesized by reacting methanol with piperidine in the presence of aluminum chloride and sodium borohydride in a catalytic amount. The nitrogen atom in this compound is a chiral center, which means it cannot exist as two enantiomers. This product also reacts with chloride to form ethylmagnesium chloride, which is used for the production of aminoalcohols.

Formula: C₁₅H₂₁NO₂

Purity: Min. 95%

Molecular weight: 247.33 g/mol

Ref: 3D-CDA03434