CAS 7706-68-5

3-(2-Methoxyphenyl)-2-butenoic acid

Description:

3-(2-Methoxyphenyl)-2-butenoic acid, identified by its CAS number 7706-68-5, is an organic compound characterized by its unique structure, which includes a butenoic acid moiety and a methoxy-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to the presence of the methoxy group, which can enhance its lipophilicity. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit acidic behavior in solution. Additionally, the compound may display biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its structural features may also influence its interactions with biological targets, potentially leading to various applications in drug development or as a chemical intermediate. Overall, 3-(2-Methoxyphenyl)-2-butenoic acid represents a versatile compound with significant implications in organic synthesis and medicinal chemistry.

Formula: C₁₁H₁₂O₃

InChI: InChI=1S/C11H12O3/c1-8(7-11(12)13)9-5-3-4-6-10(9)14-2/h3-7H,1-2H3,(H,12,13)

InChI key: InChIKey=UWTDXUCLTQHOJU-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)(C)C1=C(OC)C=CC=C1

Synonyms:

• 3-(2-Methoxyphenyl)-2-butenoic acid
• Cinnamic acid, o-methoxy-β-methyl-
• 2-Butenoic acid, 3-(2-methoxyphenyl)-

3-(2-Methoxyphenyl)but-2-enoic acid

CAS: 7706-68-5

Versatile small molecule scaffold

Formula: C₁₁H₁₂O₃

Purity: Min. 95%

Molecular weight: 192.21 g/mol

Ref: 3D-HAA70668