CAS 770703-33-8

N-benzyl-2-(2,6-dimethoxyphenoxy)ethanamine

Description:

N-benzyl-2-(2,6-dimethoxyphenoxy)ethanamine, identified by its CAS number 770703-33-8, is an organic compound characterized by its complex structure, which includes a benzyl group and a 2,6-dimethoxyphenoxy moiety attached to an ethanamine backbone. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of methoxy groups enhances its lipophilicity, potentially affecting its biological activity and interaction with cellular targets. N-benzyl-2-(2,6-dimethoxyphenoxy)ethanamine may be of interest in medicinal chemistry due to its structural features that could contribute to pharmacological properties. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for applications in drug development or as a biochemical probe. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₁₇H₂₁NO₃

InChI: InChI=1/C17H21NO3/c1-19-15-9-6-10-16(20-2)17(15)21-12-11-18-13-14-7-4-3-5-8-14/h3-10,18H,11-13H2,1-2H3

SMILES: COc1cccc(c1OCCNCc1ccccc1)OC