CAS 77074-49-8
:Thyroxine sulfate
Description:
Thyroxine sulfate, with the CAS number 77074-49-8, is a sulfated derivative of thyroxine, a hormone produced by the thyroid gland. It plays a crucial role in regulating metabolism, growth, and development in the body. The chemical structure of thyroxine sulfate includes a phenolic ring and an amino acid backbone, which are characteristic of thyroid hormones. The sulfate group enhances its solubility in water, influencing its biological activity and pharmacokinetics. Thyroxine sulfate is typically involved in various biochemical pathways and may be studied for its potential therapeutic applications, particularly in conditions related to thyroid function. It is important to note that while thyroxine itself is a well-known hormone, the sulfate form may have distinct physiological effects and interactions. As with many biochemical substances, its stability, reactivity, and interactions with other molecules can vary based on environmental conditions such as pH and temperature. Overall, thyroxine sulfate is significant in both physiological contexts and potential clinical applications.
Formula:C15H11I4NO7S
InChI:InChI=1S/C15H11I4NO7S/c16-8-1-6(3-12(20)15(21)22)2-9(17)13(8)26-7-4-10(18)14(11(19)5-7)27-28(23,24)25/h1-2,4-5,12H,3,20H2,(H,21,22)(H,23,24,25)/t12-/m0/s1
InChI key:InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-N
SMILES:O(C1=CC(I)=C(OS(=O)(=O)O)C(I)=C1)C2=C(I)C=C(C[C@@H](C(O)=O)N)C=C2I
Synonyms:- L-Tyrosine, O-[3,5-diiodo-4-(sulfooxy)phenyl]-3,5-diiodo-
- (S)-2-Amino-3-(4-(3,5-diiodo-4-(sulfooxy)phenoxy)-3,5-diiodophenyl)propanoic acid
- Thyroxine, hydrogen sulfate
- O-[3,5-Diiodo-4-(sulfooxy)phenyl]-3,5-diiodo-L-tyrosine
- Thyroxine sulfate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Thyroxine sulfate
CAS:Thyroxine sulfate is a sulfoconjugated derivative of Thyroxine and is also a metabolite of Thyroxine.Formula:C15H11I4NO7SColor and Shape:SolidMolecular weight:856.93
