CymitQuimica logo

CAS 770742-93-3

:

D-Cysteine,S-2-propen-1-yl-

Description:
D-Cysteine, S-2-propen-1-yl- is an organosulfur compound characterized by the presence of a thiol (-SH) group and an allyl group (-CH=CH2) attached to the cysteine backbone. This compound is a derivative of cysteine, an amino acid that plays a crucial role in protein synthesis and various metabolic processes. The presence of the propenyl group introduces unique reactivity, making it potentially useful in organic synthesis and biochemical applications. D-Cysteine is known for its antioxidant properties, which can help in protecting cells from oxidative stress. Additionally, it may participate in various biochemical pathways, including those related to the synthesis of glutathione, a vital antioxidant in the body. The compound's structure allows it to engage in thiol-disulfide exchange reactions, which are important in protein folding and stability. As with many sulfur-containing compounds, it may exhibit distinct odor characteristics and can be sensitive to oxidation. Overall, D-Cysteine, S-2-propen-1-yl- is a compound of interest in both research and potential therapeutic applications.
Formula:C6H11NO2S
InChI:InChI=1S/C6H11NO2S/c1-2-3-10-4-5(7)6(8)9/h2,5H,1,3-4,7H2,(H,8,9)/t5-/m1/s1
InChI key:ZFAHNWWNDFHPOH-RXMQYKEDSA-N
SMILES:C=CCSC[C@H](C(=O)O)N
Synonyms:
  • D-Cysteine,S-2-propenyl- (9CI)
Found 4 products.