CymitQuimica logo

CAS 77083-99-9

:

2-phenyl-1-benzofuran-7-amine

Description:
2-Phenyl-1-benzofuran-7-amine, with the CAS number 77083-99-9, is an organic compound characterized by its fused benzofuran and phenyl structures. This compound features a benzofuran ring system, which consists of a fused benzene and furan ring, and an amine group attached at the 7-position of the benzofuran. The presence of the phenyl group enhances its aromatic character and may influence its chemical reactivity and interactions. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The amine functional group can participate in hydrogen bonding, affecting solubility and reactivity. Additionally, the compound's structure suggests potential applications in organic synthesis and materials science. However, specific properties such as melting point, boiling point, solubility, and spectral data would require empirical measurement or literature reference for precise characterization. Overall, 2-phenyl-1-benzofuran-7-amine represents a unique structure with potential implications in various chemical and pharmaceutical contexts.
Formula:C14H11NO
InChI:InChI=1/C14H11NO/c15-12-8-4-7-11-9-13(16-14(11)12)10-5-2-1-3-6-10/h1-9H,15H2
SMILES:c1ccc(cc1)c1cc2cccc(c2o1)N
Synonyms:
  • 7-Amino-2-phenylbenzofuran
  • 7-Benzofuranamine, 2-Phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.