CAS 7709-13-9

4-chloro-1,3,5-triazin-2-amine

Description:

4-Chloro-1,3,5-triazin-2-amine, with the CAS number 7709-13-9, is a heterocyclic organic compound characterized by a triazine ring structure. This compound features a chlorine atom and an amino group attached to the triazine ring, which contributes to its reactivity and potential applications. It is typically a white to light yellow crystalline solid that is soluble in polar solvents. The presence of the amino group allows for hydrogen bonding, enhancing its solubility and reactivity in various chemical reactions. This compound is often utilized in agricultural chemistry, particularly as a herbicide or in the synthesis of other chemical products. Its chlorinated structure can impart specific biological activity, making it of interest in both industrial and research settings. Safety considerations should be taken into account, as with many chlorinated compounds, due to potential toxicity and environmental impact. Proper handling and disposal methods are essential to mitigate any risks associated with its use.

Formula: C₃H₃ClN₄

InChI: InChI=1/C3H3ClN4/c4-2-6-1-7-3(5)8-2/h1H,(H2,5,6,7,8)

SMILES: c1nc(Cl)nc(=N)[nH]1

Synonyms:

• 1,3,5-Triazin-2-amine, 4-chloro-

4-AMino-2-chloro-1,3,5-triazine

CAS: 7709-13-9

Formula: C₃H₃ClN₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 130.5357

Ref: IN-DA00G4ZB

4-Chloro-1,3,5-triazin-2-amine

CAS: 7709-13-9

4-Chloro-1,3,5-triazin-2-amine

Purity: 98%

Ref: 54-OR1038948

4-Chloro-1,3,5-triazin-2-amine

CAS: 7709-13-9

Purity: 98%

Molecular weight: 130.5399933

Ref: 10-F615830

4-Amino-2-chloro-1,3,5-triazine

CAS: 7709-13-9

4-Amino-2-chloro-1,3,5-triazine is a potent soil microorganism that utilizes reactive amines and naphthalene as its sole carbon source. It is a polymorphic species that can form four different types of crystals, which are typically found in untreated soil samples. 4-Amino-2-chloro-1,3,5-triazine can be used for the biotransformation of chaperones and detoxification of xenobiotics. It is also capable of deaminating hydrophobic compounds.

Formula: C₃H₃ClN₄

Purity: Min. 95%

Molecular weight: 130.54 g/mol

Ref: 3D-HAA70913