CAS 77092-83-2
:1,12-Dibutyl 2,5,8,11-tetraoxadodecanedioate
Description:
1,12-Dibutyl 2,5,8,11-tetraoxadodecanedioate, with CAS number 77092-83-2, is a synthetic organic compound characterized by its structure, which includes a dodecanedioate backbone with two butyl groups and four ether linkages (oxygens) integrated into the chain. This compound is typically classified as a polyether or polyol due to the presence of multiple ether functional groups, which contribute to its solubility in various organic solvents and potential applications in polymer chemistry. The presence of butyl groups enhances its hydrophobic properties, making it suitable for use in formulations requiring low water solubility. Additionally, the tetraoxadodecanedioate structure may impart flexibility and thermal stability, which are advantageous in materials science. Its unique chemical properties may also allow for applications in surfactants, plasticizers, or as intermediates in the synthesis of more complex molecules. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe usage in laboratory or industrial settings.
Formula:C16H30O8
InChI:InChI=1S/C16H30O8/c1-3-5-7-21-15(17)23-13-11-19-9-10-20-12-14-24-16(18)22-8-6-4-2/h3-14H2,1-2H3
InChI key:InChIKey=PZAPTWKIUWTDQR-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOC(OCCCC)=O)(OCCCC)=O
Synonyms:- 2,5,8,11-Tetraoxadodecanedioic acid, dibutyl ester
- 2,5,8,11-Tetraoxadodecanedioic acid, 1,12-dibutyl ester
- 1,12-Dibutyl 2,5,8,11-tetraoxadodecanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
