CAS 77095-51-3
:1-benzofuran-6-carboxylic acid
Description:
1-Benzofuran-6-carboxylic acid is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. This compound features a carboxylic acid functional group (-COOH) at the 6-position of the benzofuran ring, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water, methanol, and ethanol, while being less soluble in non-polar solvents. The presence of the carboxylic acid group allows for potential reactivity in various chemical reactions, including esterification and amidation. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure and functional groups can influence its physical and chemical properties, such as melting point, boiling point, and reactivity. As with many organic compounds, safety precautions should be taken when handling 1-benzofuran-6-carboxylic acid, as it may pose health risks if ingested or inhaled.
Formula:C9H6O3
InChI:InChI=1/C9H6O3/c10-9(11)7-2-1-6-3-4-12-8(6)5-7/h1-5H,(H,10,11)
InChI key:RVDHGRQELZPGCO-UHFFFAOYSA-N
SMILES:c1cc(cc2c1cco2)C(=O)O
Synonyms:- 6-Benzofurancarboxylic Acid
- Benzofuran-6-Carboxylic Acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Benzofuran-6-carboxylic acid
CAS:Benzofuran-6-carboxylic acidFormula:C9H6O3Purity:98%Molecular weight:162.142146-Benzofurancarboxylic acid
CAS:Formula:C9H6O3Purity:98%Color and Shape:SolidMolecular weight:162.1421Benzofuran-6-carboxylic acid
CAS:Formula:C9H6O3Purity:95%Color and Shape:SolidMolecular weight:162.144Benzofuran-6-carboxylic acid
CAS:Benzofuran-6-carboxylic acidFormula:C9H6O3Purity:98%Molecular weight:162.14Benzofuran-6-carboxylic Acid
CAS:Controlled ProductApplications Benzofuran-6-carboxylic Acid is a reagent in the development of potent LFA-1/ICAM antagonist SAR 118 as an opthalmic solution for treating dry eyes. Preparation of piperidinylpyrimidine derivatives as inhibitors of HIV-1 LTR activation.
References Zhong, M., et al.: ACS Med. Chem., 3, 203 (2012); Fujiwara, N., et al.: Bioorg. Med. Chem., 16, 9804 (2008)Formula:C9H6O3Color and Shape:NeatMolecular weight:162.141-Benzofuran-6-carboxylic acid
CAS:Please enquire for more information about 1-Benzofuran-6-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C9H6O3Purity:Min. 95%Color and Shape:PowderMolecular weight:162.14 g/mol








