CAS 77099-20-8
:2-(4-hydroxyphenyl)-7-methoxy-4-oxo-4H-chromen-5-yl 6-O-beta-D-xylopyranosyl-beta-D-glucopyranoside
Description:
The chemical substance known as 2-(4-hydroxyphenyl)-7-methoxy-4-oxo-4H-chromen-5-yl 6-O-beta-D-xylopyranosyl-beta-D-glucopyranoside, with the CAS number 77099-20-8, is a glycosylated flavonoid compound. It features a chromone backbone, which is characteristic of many flavonoids, and is substituted with a hydroxyphenyl group and a methoxy group, contributing to its potential biological activity. The presence of the xylopyranosyl and glucopyranosyl moieties indicates that this compound is a glycoside, which may enhance its solubility and bioavailability. Such compounds are often studied for their antioxidant, anti-inflammatory, and potential therapeutic properties. The structural complexity suggests that it may exhibit specific interactions with biological targets, making it of interest in pharmacological research. Additionally, the presence of multiple hydroxyl groups can contribute to its reactivity and ability to form hydrogen bonds, influencing its behavior in biological systems. Overall, this compound represents a fascinating area of study within natural product chemistry and pharmacognosy.
Formula:C27H30O14
InChI:InChI=1/C27H30O14/c1-36-13-6-17-20(14(29)8-16(39-17)11-2-4-12(28)5-3-11)18(7-13)40-27-25(35)23(33)22(32)19(41-27)10-38-26-24(34)21(31)15(30)9-37-26/h2-8,15,19,21-28,30-35H,9-10H2,1H3/t15-,19-,21+,22-,23+,24-,25-,26+,27-/m1/s1
Synonyms:- 4H-1-Benzopyran-4-one, 2-(4-hydroxyphenyl)-7-methoxy-5-((6-O-beta-D-xylopyranosyl-beta-D-glucopyranosyl)oxy)-
- Genkwanin 5-O-primveroside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4H-1-Benzopyran-4-one,2-(4-hydroxyphenyl)-7-methoxy-5-[(6-O-b-D-xylopyranosyl-b-D-glucopyranosyl)oxy]-
CAS:Formula:C27H30O14Purity:95%Color and Shape:SolidMolecular weight:578.5187Yuankanin
CAS:<p>Yuankanin, a natural compound found in thyme leaves, Daphne gnidium and Daphne feddei, is a genkwanin-5-bioside with anthelmintic activity.</p>Formula:C27H30O14Purity:98.38%Color and Shape:SolidMolecular weight:578.52Yuankanin
CAS:Controlled Product<p>Yuankanin is an herbal extract derived from the bark of the Rhodoleia championii plant, which is native to subtropical regions. This botanical source has been traditionally used in various medicinal practices due to its bioactive compounds. The primary mode of action involves the inhibition of pro-inflammatory cytokines and the modulation of immune responses, which contributes to its proposed benefits in reducing inflammation.</p>Formula:C27H30O14Purity:Min. 95%Molecular weight:578.50 g/mol




