CymitQuimica logo

CAS 771-19-7

:

1-hydroxy-3,4-dihydroquinolin-2(1H)-one

Description:
1-Hydroxy-3,4-dihydroquinolin-2(1H)-one, with the CAS number 771-19-7, is a heterocyclic organic compound characterized by its quinoline structure, which includes a hydroxyl group and a carbonyl group. This compound typically appears as a solid and is known for its potential biological activities, including antimicrobial and anti-inflammatory properties. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in various chemical reactions, such as hydrogen bonding and nucleophilic attacks. Its molecular structure also suggests that it may exhibit fluorescence, making it of interest in various analytical applications. Additionally, derivatives of this compound have been studied for their potential therapeutic effects, particularly in the fields of medicinal chemistry and drug development. As with many organic compounds, its solubility and stability can vary depending on the solvent and environmental conditions, which are important considerations in its practical applications.
Formula:C9H9NO2
InChI:InChI=1/C9H9NO2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-4,12H,5-6H2
SMILES:c1ccc2c(c1)CCC(=O)N2O
Synonyms:
  • 2(1H)-quinolinone, 3,4-dihydro-1-hydroxy-
  • 3,4-Dihydro-1-hydroxycarbostyril
  • Carbostyril, 3,4-dihydro-1-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.