CAS 771-26-6
:4-hydroxy-2H-1,4-benzoxazin-3(4H)-one
Description:
4-Hydroxy-2H-1,4-benzoxazin-3(4H)-one, with the CAS number 771-26-6, is a chemical compound belonging to the class of benzoxazinones. It is characterized by a bicyclic structure that includes a benzene ring fused to a 1,4-oxazinone moiety. This compound typically exhibits a white to pale yellow crystalline appearance and is soluble in polar organic solvents. It is known for its role in plant defense mechanisms, particularly in certain grasses, where it acts as a natural herbicide and insect repellent. The presence of the hydroxyl group contributes to its reactivity and potential for hydrogen bonding, influencing its biological activity. Additionally, 4-hydroxy-2H-1,4-benzoxazin-3(4H)-one has been studied for its potential applications in pharmaceuticals and agrochemicals due to its diverse biological properties, including antimicrobial and antioxidant activities. Its stability and reactivity can vary depending on environmental conditions, making it an interesting subject for further research in both synthetic and natural product chemistry.
Formula:C8H7NO3
InChI:InChI=1/C8H7NO3/c10-8-5-12-7-4-2-1-3-6(7)9(8)11/h1-4,11H,5H2
SMILES:c1ccc2c(c1)N(C(=O)CO2)O
Synonyms:- 2H-1,4-benzoxazin-3(4H)-one, 4-hydroxy-
- 4-hydroxy-3,4-dihydro-2H-1,4-benzoxazin-3-one
- 4-Hydroxy-4H-benzo[1,4]oxazin-3-one
- 4-Hydroxy-2H-1,4-benzoxazin-3(4H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Hydroxy-3,4-dihydro-2H-1,4-benzoxazin-3-one
CAS:4-Hydroxy-3,4-dihydro-2H-1,4-benzoxazin-3-onePurity:techMolecular weight:165.15g/mol4-Hydroxy-3,4-dihydro-2H-1,4-benzoxazin-3-one
CAS:4-Hydroxy-3,4-dihydro-2H-1,4-benzoxazin-3-one is a chiral compound that is used in the synthesis of other pharmaceuticals. It is a synthetic compound that can be prepared by reacting boric acid with methanol and an additive such as diboa. The enantiomers are separated using an enantioseparation technique like diboa or chiral HPLC. The racemic mixture can be resolved into pure enantiomers through acetal formation followed by diastereomeric separation by column chromatography or crystallization. 4-Hydroxyl-3,4-dihydro-2H-1,4 benzoxazin 3 one is soluble in organic solvents and has a melting point of 122°C and boiling point of 282°C.Formula:C8H7NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:165.15 g/mol


