CAS 771-28-8

N'-hydroxy-2-methoxybenzenecarboximidamide

Description:

N'-hydroxy-2-methoxybenzenecarboximidamide, with the CAS number 771-28-8, is a chemical compound characterized by its unique functional groups, including a hydroxylamine and an imidamide structure. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of hydroxyl and amine functionalities. Its molecular structure features a methoxy group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the hydroxylamine group suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Additionally, compounds of this nature can exhibit biological activity, making them of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as compounds with similar structures can vary in toxicity and reactivity. Overall, N'-hydroxy-2-methoxybenzenecarboximidamide represents a versatile building block in organic chemistry with potential applications in medicinal chemistry and material science.

Formula: C₈H₁₀N₂O₂

InChI: InChI=1/C8H10N2O2/c1-12-7-5-3-2-4-6(7)8(9)10-11/h2-5,11H,1H3,(H2,9,10)

SMILES: COc1ccccc1C(=N)NO

2-Methoxybenzamidoxime

CAS: 771-28-8

Formula: C₈H₁₀N₂O₂

Molecular weight: 166.1772

Ref: IN-DA008NZD

N'-Hydroxy-2-methoxy-benzamidine

CAS: 771-28-8

N'-Hydroxy-2-methoxy-benzamidine

Purity: 95%

Molecular weight: 166.18g/mol

Ref: 54-OR346058