CAS 771-45-9

N-(2-fluoro-6-methylphenyl)acetamide

Description:

N-(2-fluoro-6-methylphenyl)acetamide, with the CAS number 771-45-9, is an organic compound characterized by its amide functional group. This substance features a phenyl ring substituted with a fluorine atom at the 2-position and a methyl group at the 6-position, contributing to its unique chemical properties. The presence of the acetamide group enhances its solubility in polar solvents and may influence its reactivity in various chemical reactions. Typically, compounds like this can exhibit biological activity, making them of interest in pharmaceutical research. The fluorine substitution can affect the compound's lipophilicity and metabolic stability, which are critical factors in drug design. Additionally, the molecular structure suggests potential for hydrogen bonding due to the amide group, which can play a role in its interactions with biological targets. Overall, N-(2-fluoro-6-methylphenyl)acetamide is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.

Formula: C₉H₁₀FNO

InChI: InChI=1/C9H10FNO/c1-6-4-3-5-8(10)9(6)11-7(2)12/h3-5H,1-2H3,(H,11,12)

2-Acetamino-3-fluorotoluene

CAS: 771-45-9

Formula: C₉H₁₀FNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 167.1802

Ref: IN-DA021RPT