CAS 77102-29-5

2-[[[2-[(Aminoiminomethyl)amino]ethyl]thio]methyl]-2-propenoic acid

Description:

The chemical substance known as 2-[[[2-[(Aminoiminomethyl)amino]ethyl]thio]methyl]-2-propenoic acid, with the CAS number 77102-29-5, is a complex organic compound characterized by its functional groups and structural features. It contains an amino group, which contributes to its basicity and potential reactivity in biological systems. The presence of a thioether linkage indicates that it may participate in redox reactions or serve as a nucleophile. The propenoic acid moiety suggests that it can undergo polymerization or participate in Michael addition reactions, making it useful in various synthetic applications. This compound may exhibit properties such as solubility in polar solvents due to its amino and carboxylic acid groups, and it could potentially act as a ligand in coordination chemistry. Additionally, its structural complexity may impart unique biological activities, making it of interest in pharmaceutical research. Overall, this substance's diverse functional groups and potential reactivity highlight its significance in both synthetic and biological chemistry contexts.

Formula: C₇H₁₃N₃O₂S

InChI: InChI=1S/C7H13N3O2S/c1-5(6(11)12)4-13-3-2-10-7(8)9/h1-4H2,(H,11,12)(H4,8,9,10)

InChI key: InChIKey=IHMMEFLVYSASAM-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)=C)SCCNC(=N)N

Synonyms:

• 2-Propenoic acid, 2-[[[2-[(aminoiminomethyl)amino]ethyl]thio]methyl]-
• 2-[[[2-[(Aminoiminomethyl)amino]ethyl]thio]methyl]-2-propenoic acid
• α-(Guanidinoethylthiomethyl)acrylic acid

α-(Guanidinoethylthiomethyl)acrylic Acid

Controlled Product

CAS: 77102-29-5

Formula: C₇H₁₃N₃O₂S

Color and Shape: Neat

Molecular weight: 203.262

Ref: TR-G821260