
CAS 77110-11-3
:Poly(dibenzo-18-crown-6)
Description:
Poly(dibenzo-18-crown-6) is a synthetic polymer that belongs to the class of crown ethers, specifically designed to exhibit selective binding properties for cations. Its structure features a repeating unit derived from dibenzo-18-crown-6, which consists of a cyclic ether framework with multiple oxygen atoms that can coordinate with metal ions. This polymer is characterized by its ability to form stable complexes with various cations, particularly alkali and alkaline earth metals, due to the size and shape of its cavity, which is tailored to accommodate specific ions. Poly(dibenzo-18-crown-6) is often utilized in applications such as ion-selective electrodes, extraction processes, and as a ligand in coordination chemistry. Its solubility can vary depending on the solvent and the presence of substituents, and it may exhibit unique thermal and mechanical properties due to its polymeric nature. Additionally, the polymer's ability to selectively bind ions makes it valuable in environmental and analytical chemistry for the detection and separation of metal ions.
Formula:(C20H24O6)x
InChI:InChI=1S/C20H24O6/c1-2-6-18-17(5-1)23-13-9-21-11-15-25-19-7-3-4-8-20(19)26-16-12-22-10-14-24-18/h1-8H,9-16H2
InChI key:InChIKey=YSSSPARMOAYJTE-UHFFFAOYSA-N
SMILES:C=12C(=CC=CC1)OCCOCCOC=3C(OCCOCCO2)=CC=CC3
Synonyms:- Dibenzo[b,k][1,4,7,10,13,16]hexaoxacyclooctadecin, 6,7,9,10,17,18,20,21-octahydro-, homopolymer
- Poly(dibenzo-18-crown-6)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
