CymitQuimica logo

CAS 77112-27-7

:

2-Bromo-N-(3-chlorophenyl)propanamide

Description:
2-Bromo-N-(3-chlorophenyl)propanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a bromine atom and a chlorophenyl group contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the halogen substituents. The bromine and chlorine atoms can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the aromatic chlorophenyl group may impart specific biological activities, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may exhibit moderate to high lipophilicity, affecting its distribution in biological systems. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-Bromo-N-(3-chlorophenyl)propanamide serves as a valuable compound in synthetic organic chemistry and pharmaceutical research.
Formula:C9H9BrClNO
InChI:InChI=1S/C9H9BrClNO/c1-6(10)9(13)12-8-4-2-3-7(11)5-8/h2-6H,1H3,(H,12,13)
InChI key:InChIKey=AQCUZZDNJGESDZ-UHFFFAOYSA-N
SMILES:N(C(C(Br)C)=O)C1=CC(Cl)=CC=C1
Synonyms:
  • Propanamide, 2-bromo-N-(3-chlorophenyl)-
  • Propionanilide, 2-bromo-3′-chloro-
  • 2-Bromo-N-(3-chlorophenyl)propanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.