CAS 77112-66-4

5-bromo-3-ethoxypyrazin-2-amine

Description:

5-Bromo-3-ethoxypyrazin-2-amine is a chemical compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a bromine atom at the 5-position and an ethoxy group at the 3-position contributes to its unique reactivity and properties. This compound typically exhibits moderate solubility in organic solvents due to the ethoxy group, while its polar amine functionality can enhance solubility in polar solvents. The bromine substituent can serve as a site for further chemical modifications, making it useful in synthetic organic chemistry. Additionally, the presence of the amine group suggests potential for hydrogen bonding, influencing its interactions in biological systems. Compounds like this may be of interest in pharmaceutical research, particularly in the development of new drugs or agrochemicals, due to their potential biological activity. As with many halogenated compounds, safety precautions should be taken when handling, as brominated compounds can pose environmental and health risks.

Formula: C₆H₈BrN₃O

InChI: InChI=1/C6H8BrN3O/c1-2-11-6-5(8)9-3-4(7)10-6/h3H,2H2,1H3,(H2,8,9)

SMILES: CCOc1c(N)ncc(Br)n1

Synonyms:

• 2-Pyrazinamine, 5-Bromo-3-Ethoxy-
• 5-Bromo-3-ethoxypyrazin-2-amine

2-Amino-5-bromo-3-ethoxypyrazine

CAS: 77112-66-4

Formula: C₆H₈BrN₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 218.0512

Ref: IN-DA005667

2-Amino-5-bromo-3-ethoxypyrazine

CAS: 77112-66-4

2-Amino-5-bromo-3-ethoxypyrazine

Purity: 98%

Molecular weight: 218.05g/mol

Ref: 54-OR90825

2-Amino-5-bromo-3-ethoxypyrazine

CAS: 77112-66-4

Formula: C₆H₈BrN₃O

Purity: 97%

Molecular weight: 218.054

Ref: 10-F092409