CAS 7712-28-9

3-(3-oxo-3,4-dihydroquinoxalin-2-yl)propanoate

Description:

The chemical substance known as 3-(3-oxo-3,4-dihydroquinoxalin-2-yl)propanoate, with the CAS number 7712-28-9, is a compound that features a quinoxaline moiety, which is a bicyclic structure containing two nitrogen atoms. This compound typically exhibits characteristics such as being a solid at room temperature and may have moderate solubility in polar solvents due to the presence of functional groups. The presence of the propanoate group suggests that it may have acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, quinoxaline derivatives are known for their biological activities, which may include antimicrobial and anticancer properties, making this compound of interest in medicinal chemistry. Its molecular structure contributes to its reactivity and potential applications in pharmaceuticals and organic synthesis. As with many chemical substances, safety data should be consulted to understand its handling and toxicity.

Formula: C₁₁H₉N₂O₃

InChI: InChI=1/C11H10N2O3/c14-10(15)6-5-9-11(16)13-8-4-2-1-3-7(8)12-9/h1-4H,5-6H2,(H,13,16)(H,14,15)/p-1

SMILES: c1ccc2c(c1)nc(CCC(=O)[O-])c(=O)[nH]2

2-Quinoxalinepropanoicacid, 3,4-dihydro-3-oxo-

CAS: 7712-28-9

Formula: C₁₁H₁₀N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 218.2087

Ref: IN-DA008NZM

3-(3-Oxo-3,4-dihydro-quinoxalin-2-yl)-propionic acid

CAS: 7712-28-9

3-(3-Oxo-3,4-dihydro-quinoxalin-2-yl)-propionic acid

Purity: 95%

Molecular weight: 218.2087g/mol

Ref: 54-OR96523

3-(3-hydroxyquinoxalin-2-yl)propanoic acid

CAS: 7712-28-9

Formula: C₁₁H₁₀N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 218.212

Ref: 10-F314915