CymitQuimica logo

CAS 77123-63-8

:

4-Fluoro-3-[2-(trimethylsilyl)ethynyl]benzenamine

Description:
4-Fluoro-3-[2-(trimethylsilyl)ethynyl]benzenamine, with the CAS number 77123-63-8, is an organic compound characterized by the presence of a fluorobenzene ring substituted with an ethynyl group that is further modified by a trimethylsilyl group. This compound features a fluorine atom, which can influence its electronic properties and reactivity, making it useful in various synthetic applications. The trimethylsilyl group enhances the compound's stability and solubility, often facilitating reactions in organic synthesis. The presence of the ethynyl group suggests potential for further functionalization, allowing for the creation of more complex molecules. Additionally, the amine functional group indicates that the compound can participate in hydrogen bonding, which may affect its physical properties such as boiling point and solubility in polar solvents. Overall, this compound is of interest in fields such as medicinal chemistry and materials science, where its unique structural features can be leveraged for the development of new drugs or materials.
Formula:C11H14FNSi
InChI:InChI=1S/C11H14FNSi/c1-14(2,3)7-6-9-8-10(13)4-5-11(9)12/h4-5,8H,13H2,1-3H3
InChI key:InChIKey=UACQHSQWXWUFLT-UHFFFAOYSA-N
SMILES:C(#C[Si](C)(C)C)C1=C(F)C=CC(N)=C1
Synonyms:
  • 4-Fluoro-3-[(trimethylsilyl)ethynyl]benzenamine
  • Benzenamine, 4-fluoro-3-[(trimethylsilyl)ethynyl]-
  • 4-Fluoro-3-[2-(trimethylsilyl)ethynyl]benzenamine
  • [4-Fluoro-3-[(trimethylsilanyl)ethynyl]phenyl]amine
  • Benzenamine, 4-fluoro-3-[2-(trimethylsilyl)ethynyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.