CAS 77128-72-4
:Fmoc-Tyr(Me)-OH
Description:
Fmoc-Tyr(Me)-OH, also known as Fmoc-tyrosine methyl ester, is a derivative of the amino acid tyrosine, where the amino group is protected by a fluorenylmethoxycarbonyl (Fmoc) group, and the hydroxyl group of tyrosine is methylated. This compound is commonly used in peptide synthesis as a building block due to its stability and ease of handling. The Fmoc group serves as a protective group that can be removed under basic conditions, allowing for selective deprotection during peptide assembly. The methyl ester enhances the lipophilicity of the tyrosine residue, which can influence the solubility and reactivity of the compound in various chemical environments. Fmoc-Tyr(Me)-OH is typically characterized by its molecular weight, solubility in organic solvents, and its ability to participate in coupling reactions with other amino acids. Its applications extend to the fields of medicinal chemistry and biochemistry, particularly in the synthesis of peptides and proteins for research and therapeutic purposes.
Formula:C25H23NO5
InChI:InChI=1/C25H23NO5/c1-30-17-12-10-16(11-13-17)14-23(24(27)28)26-25(29)31-15-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,26,29)(H,27,28)/t23-/m0/s1
SMILES:COc1ccc(cc1)C[C@@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- N-alpha-(9-fluorenylmethyloxycarbonyl)-O-methyl-L-tyrosine
- N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-methyl-L-tyrosine
- Fmoc-4-Methoxy-L-phenylalanine
- Fmoc-4-Methoxyphenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-O-methyl-L-tyrosine
CAS:Formula:C25H23NO5Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:417.46N-Fmoc-4-methoxy-L-phenylalanine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C25H23NO5Purity:95%Molecular weight:417.45Fmoc-Tyr(Me)-OH
CAS:Building block for oxytocin and vasopressin analogs as carbetocin, and for structure-activity studies.Formula:C25H23NO5Purity:99.7%Color and Shape:White PowderMolecular weight:417.46Fmoc-O-methyl-L-tyrosine
CAS:Formula:C25H23NO5Purity:95%Color and Shape:SolidMolecular weight:417.4538Ref: IN-DA0034Y5
1g25.00€5g46.00€10g64.00€25g121.00€50g184.00€100g251.00€250g527.00€500gTo inquire250mg24.00€Fmoc-4-Methoxy-L-phenylalanine
CAS:Fmoc-4-Methoxy-L-phenylalanine
Formula:C25H23NO5Purity:98%Color and Shape: white to off-white solidMolecular weight:417.45g/molFmoc-L-tyrosine methyl ether
CAS:Formula:C25H23NO5Purity:95%Color and Shape:SolidMolecular weight:417.461







