CAS 7713-76-0

2-(4-bromophenyl)-N-methylacetamide

Description:

2-(4-Bromophenyl)-N-methylacetamide, with the CAS number 7713-76-0, is an organic compound characterized by its amide functional group, which features a bromophenyl moiety and a methyl group attached to the nitrogen. This compound typically appears as a solid or crystalline substance and is known for its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water due to its hydrophobic bromophenyl group. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The compound may exhibit various properties, including potential antimicrobial or anti-inflammatory effects, depending on its specific interactions within biological systems. Additionally, its molecular structure allows for potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals. Safety data should be consulted, as halogenated compounds can pose environmental and health risks.

Formula: C₉H₁₀BrNO

InChI: InChI=1/C9H10BrNO/c1-11-9(12)6-7-2-4-8(10)5-3-7/h2-5H,6H2,1H3,(H,11,12)

SMILES: CN=C(Cc1ccc(cc1)Br)O

2-(4-Bromophenyl)-N-methylacetamide

CAS: 7713-76-0

Formula: C₉H₁₀BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 228.0858

Ref: IN-DA005Q7B

2-(4-Bromophenyl)-N-methylacetamide

CAS: 7713-76-0

2-(4-Bromophenyl)-N-methylacetamide

Formula: C₉H₁₀BrNO

Purity: 96%

Color and Shape: light yellow solid

Molecular weight: 228.09g/mol

Ref: 54-OR907627

2-(4-bromophenyl)-N-methylacetamide

CAS: 7713-76-0

Formula: C₉H₁₀BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 228.089

Ref: 10-F314877