
CAS 77133-42-7
:3-(β-D-Glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,8-dimethoxy-4H-1-benzopyran-4-one
Description:
The chemical substance known as 3-(β-D-Glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,8-dimethoxy-4H-1-benzopyran-4-one, with the CAS number 77133-42-7, is a flavonoid glycoside. This compound features a complex structure characterized by a benzopyran backbone, which is a common feature in flavonoids, and is substituted with multiple hydroxyl and methoxy groups that contribute to its biological activity. The presence of the β-D-glucopyranosyl moiety indicates that it is a glycoside, which can enhance its solubility and bioavailability. This compound is known for its potential antioxidant properties, which may provide protective effects against oxidative stress. Additionally, flavonoids like this one are often studied for their anti-inflammatory, antimicrobial, and anticancer activities. Its intricate structure and functional groups suggest that it may interact with various biological pathways, making it a subject of interest in pharmacological research. Overall, this compound exemplifies the diverse chemistry of flavonoids and their potential applications in health and medicine.
Formula:C24H26O14
InChI:InChI=1S/C24H26O14/c1-33-10-6-8(4-5-9(10)26)19-23(38-24-17(31)16(30)13(27)11(7-25)36-24)15(29)12-14(28)21(34-2)18(32)22(35-3)20(12)37-19/h4-6,11,13,16-17,24-28,30-32H,7H2,1-3H3/t11-,13-,16+,17-,24+/m1/s1
InChI key:InChIKey=PRBUAZIWXABBBW-BFECWXROSA-N
SMILES:O(C)C1=C2C(C(=O)C(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)=C(O2)C4=CC(OC)=C(O)C=C4)=C(O)C(OC)=C1O
Synonyms:- Limocitrol 3-β-D-glucoside
- 4H-1-Benzopyran-4-one, 3-(β-D-glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,8-dimethoxy-
- 3-(β-D-Glucopyranosyloxy)-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,8-dimethoxy-4H-1-benzopyran-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Limocitrol 3-glucoside
CAS:Limocitrol 3-glucoside is a natural flavonoid glycoside widely used in biochemical experiments and drug synthesis research.Formula:C24H26O14Color and Shape:SolidMolecular weight:538.46
