CAS 77133-61-0
:tyr-pro-leu-gly amide
Description:
Tyr-Pro-Leu-Gly amide, also known by its CAS number 77133-61-0, is a synthetic peptide that consists of four amino acids: tyrosine (Tyr), proline (Pro), leucine (Leu), and glycine (Gly), with an amide functional group at the terminal end. This compound is characterized by its specific sequence of amino acids, which contributes to its unique biochemical properties and potential biological activities. Peptides like Tyr-Pro-Leu-Gly amide are often studied for their roles in various physiological processes, including signaling pathways and regulatory functions in biological systems. The presence of the amide group enhances the stability of the peptide, making it less susceptible to enzymatic degradation compared to free amino acids. Additionally, the hydrophobic nature of leucine and the unique structural properties of proline can influence the peptide's conformation and interactions with other biomolecules. Such peptides may have applications in pharmaceuticals, biotechnology, and research, particularly in the fields of drug design and development.
Formula:C22H33N5O5
InChI:InChI=1/C22H33N5O5/c1-13(2)10-17(20(30)25-12-19(24)29)26-21(31)18-4-3-9-27(18)22(32)16(23)11-14-5-7-15(28)8-6-14/h5-8,13,16-18,28H,3-4,9-12,23H2,1-2H3,(H2,24,29)(H,25,30)(H,26,31)/t16-,17-,18-/m0/s1
SMILES:CC(C)C[C@@H](C(=NCC(=N)O)O)N=C([C@@H]1CCCN1C(=O)[C@H](Cc1ccc(cc1)O)N)O
Synonyms:- (Tyr0)-Melanocyte-Stimulating Hormone-Release Inhibiting Factor
- H-Tyr-Pro-Leu-Gly-NH2
- L-tyrosyl-L-prolyl-L-norleucylglycinamide
- L-tyrosyl-L-prolyl-L-leucylglycinamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.