CAS 77134-74-8
:[5-(hydroxymethyl)-1-trityl-imidazol-4-yl]methanol
Description:
[5-(Hydroxymethyl)-1-trityl-imidazol-4-yl]methanol, with the CAS number 77134-74-8, is a chemical compound that features an imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound is characterized by the presence of a trityl group, which is a bulky phenyl group that enhances its stability and solubility in organic solvents. The hydroxymethyl group contributes to its reactivity, allowing for potential interactions in various chemical reactions, such as nucleophilic substitutions or as a building block in organic synthesis. The presence of both hydroxymethyl and trityl functionalities suggests that this compound may exhibit interesting properties in terms of solubility, reactivity, and potential applications in medicinal chemistry or as a ligand in coordination chemistry. Its structural features may also influence its biological activity, making it a candidate for further investigation in pharmaceutical research. Overall, this compound represents a unique combination of structural elements that could be valuable in various chemical applications.
Formula:C24H22N2O2
InChI:InChI=1/C24H22N2O2/c27-16-22-23(17-28)26(18-25-22)24(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,18,27-28H,16-17H2
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)n1cnc(CO)c1CO
Synonyms:- [4-(Hydroxymethyl)-1-Trityl-1H-Imidazol-5-Yl]Methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.