CAS 77143-76-1
:Ethyl ^a,4-dibromophenylacetate
Description:
Ethyl 4-dibromophenylacetate, with the CAS number 77143-76-1, is an organic compound characterized by its ester functional group, which is derived from the reaction of ethyl alcohol and 4-dibromophenylacetic acid. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive aromatic odor. The presence of bromine atoms in the phenyl ring enhances its reactivity and can influence its biological activity, making it of interest in various chemical applications, including synthesis and potential pharmaceutical uses. Ethyl 4-dibromophenylacetate is soluble in organic solvents but has limited solubility in water due to its hydrophobic characteristics. Its chemical structure contributes to its stability under normal conditions, although it may undergo hydrolysis or other reactions under specific circumstances. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested. Overall, ethyl 4-dibromophenylacetate serves as a valuable compound in organic synthesis and research.
Formula:C10H10Br2O2
InChI:InChI=1/C10H10Br2O2/c1-2-14-10(13)9(12)7-3-5-8(11)6-4-7/h3-6,9H,2H2,1H3
SMILES:CCOC(=O)C(c1ccc(cc1)Br)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl α,4-dibromophenylacetate, 97+%
CAS:It is employed as intermediate for pharmaceutical. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not chanFormula:C10H10Br2O2Purity:97+%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:321.99Ethyl 2-bromo-2-(4-bromophenyl)acetate
CAS:Formula:C10H10Br2O2Purity:95%Color and Shape:LiquidMolecular weight:321.9932Ethyl 2-Bromo-2-(4-Bromophenyl)Acetate
CAS:Ethyl 2-Bromo-2-(4-Bromophenyl)AcetatePurity:98%Molecular weight:321.99g/molEthyl 2-bromo-2-(4-bromophenyl)acetate
CAS:Formula:C10H10Br2O2Purity:95%Color and Shape:LiquidMolecular weight:321.996



