CAS 77145-51-8

1-(6-Chloro-2-pyridinyl)-4-piperidinamine

Description:

1-(6-Chloro-2-pyridinyl)-4-piperidinamine, with the CAS number 77145-51-8, is a chemical compound characterized by its unique structure, which includes a piperidine ring and a pyridine moiety. The presence of a chlorine atom at the 6-position of the pyridine ring contributes to its reactivity and potential biological activity. This compound is typically classified as an amine due to the presence of the piperidinamine functional group. It may exhibit properties such as solubility in polar solvents, and its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's characteristics, including its melting point, boiling point, and specific reactivity, would depend on its purity and the conditions under which it is studied. Additionally, safety data should be consulted to understand its handling and potential hazards, as with any chemical substance. Overall, 1-(6-Chloro-2-pyridinyl)-4-piperidinamine represents a class of compounds that may have applications in pharmaceuticals or agrochemicals.

Formula: C₁₀H₁₄ClN₃

InChI: InChI=1S/C10H14ClN3/c11-9-2-1-3-10(13-9)14-6-4-8(12)5-7-14/h1-3,8H,4-7,12H2

InChI key: InChIKey=WPVVMKYQOMJPIN-UHFFFAOYSA-N

SMILES: ClC1=NC(=CC=C1)N2CCC(N)CC2

Synonyms:

• [1-(6-Chloropyridin-2-yl)piperidin-4-yl]amine
• 1-(6-Chloro-2-pyridinyl)-4-piperidinamine
• 4-Piperidinamine, 1-(6-chloro-2-pyridinyl)-

SR57227A

CAS: 77145-51-8

SR 57227A: Selective 5-HT3 receptor inhibitor, affects NMDA responses, has anti-depressant effects and reduces aggression in rats.

Formula: C₁₀H₁₄ClN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 211.69

Ref: TM-T28850