CAS 77150-35-7

8-bromoquinazolin-4-ol

Description:

8-Bromoquinazolin-4-ol is a chemical compound characterized by its quinazoline core structure, which consists of a fused benzene and pyrimidine ring. The presence of a bromine atom at the 8-position and a hydroxyl group at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group, while its bromine substituent can influence its reactivity and potential applications in organic synthesis. 8-Bromoquinazolin-4-ol is of interest in medicinal chemistry, particularly for its potential biological activities, including antimicrobial and anticancer properties. Its reactivity can be attributed to the electron-withdrawing nature of the bromine atom, which can enhance nucleophilic attack at other positions on the molecule. Additionally, the compound may participate in various chemical reactions, such as substitution and coupling reactions, making it a valuable intermediate in the synthesis of more complex organic molecules.

Formula: C₈H₅BrN₂O

InChI: InChI=1/C8H5BrN2O/c9-6-3-1-2-5-7(6)10-4-11-8(5)12/h1-4H,(H,10,11,12)

SMILES: c1cc2c(c(c1)Br)ncnc2O

Synonyms:

• 4(1H)-quinazolinone, 8-bromo-
• 4(3H)-quinazolinone, 8-bromo-
• 8-Bromoquinazolin-4(1H)-one
• 8-Bromo-4(1H)-Quinazolinone

8-Bromo-4(1H)-quinazolinone

CAS: 77150-35-7

Formula: C₈H₅BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 225.0421

Ref: IN-DA005DUH

8-Bromo-4(1H)-quinazolinone

CAS: 77150-35-7

8-Bromo-4(1H)-quinazolinone

Purity: 99%

Molecular weight: 225.04g/mol

Ref: 54-OR322508

8-Bromo-4(1H)-quinazolinone

CAS: 77150-35-7

Formula: C₈H₅BrN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 225.045

Ref: 10-F076356